About 4-chloro-6,8-difluoroquinoline
4-chloro-6,8-difluoroquinoline (PubChem CID 2736502) has the molecular formula C9H4ClF2N
and a molecular weight of 199.59 g/mol. Its IUPAC name is 4-chloro-6,8-difluoroquinoline.
Molecular Properties
| Compound Name | 4-chloro-6,8-difluoroquinoline |
| PubChem CID | 2736502 |
| Molecular Formula | C9H4ClF2N |
| Molecular Weight | 199.59 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | 4-chloro-6,8-difluoroquinoline |
| SMILES | Fc1cc(F)c2nccc(Cl)c2c1 |
| InChI | InChI=1S/C9H4ClF2N/c10-7-1-2-13-9-6(7)3-5(11)4-8(9)12/h1-4H |
| InChIKey | NBYDBLFWTPXYFH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.59 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-6,8-difluoroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6,8-difluoroquinoline?
The IUPAC name of 4-chloro-6,8-difluoroquinoline (CID 2736502) is 4-chloro-6,8-difluoroquinoline.
What is the SMILES notation for 4-chloro-6,8-difluoroquinoline?
The canonical SMILES for 4-chloro-6,8-difluoroquinoline is Fc1cc(F)c2nccc(Cl)c2c1.
What is the InChIKey of 4-chloro-6,8-difluoroquinoline?
The InChIKey is NBYDBLFWTPXYFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4ClF2N/c10-7-1-2-13-9-6(7)3-5(11)4-8(9)12/h1-4H.
What are the key properties of 4-chloro-6,8-difluoroquinoline?
4-chloro-6,8-difluoroquinoline has a molecular weight of 199.59 g/mol, XLogP of 3.17, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6,8-difluoroquinoline is sourced from PubChem (CID 2736502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).