About 2H-isoquinolin-3-one
2H-isoquinolin-3-one (PubChem CID 2736554) has the molecular formula C9H7NO
and a molecular weight of 145.16 g/mol. Its IUPAC name is 2H-isoquinolin-3-one.
Molecular Properties
| Compound Name | 2H-isoquinolin-3-one |
| PubChem CID | 2736554 |
| Molecular Formula | C9H7NO |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | 2H-isoquinolin-3-one |
| SMILES | O=c1cc2ccccc2c[nH]1 |
| InChI | InChI=1S/C9H7NO/c11-9-5-7-3-1-2-4-8(7)6-10-9/h1-6H,(H,10,11) |
| InChIKey | GYPOFOQUZZUVQL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2H-isoquinolin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-isoquinolin-3-one?
The IUPAC name of 2H-isoquinolin-3-one (CID 2736554) is 2H-isoquinolin-3-one.
What is the SMILES notation for 2H-isoquinolin-3-one?
The canonical SMILES for 2H-isoquinolin-3-one is O=c1cc2ccccc2c[nH]1.
What is the InChIKey of 2H-isoquinolin-3-one?
The InChIKey is GYPOFOQUZZUVQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO/c11-9-5-7-3-1-2-4-8(7)6-10-9/h1-6H,(H,10,11).
What are the key properties of 2H-isoquinolin-3-one?
2H-isoquinolin-3-one has a molecular weight of 145.16 g/mol, XLogP of 1.53, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-isoquinolin-3-one is sourced from PubChem (CID 2736554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).