About 4-methylsulfonyl-1,1-dioxothiolan-3-ol
4-methylsulfonyl-1,1-dioxothiolan-3-ol (PubChem CID 2736578) has the molecular formula C5H10O5S2
and a molecular weight of 214.26 g/mol. Its IUPAC name is 4-methylsulfonyl-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | 4-methylsulfonyl-1,1-dioxothiolan-3-ol |
| PubChem CID | 2736578 |
| Molecular Formula | C5H10O5S2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 4-methylsulfonyl-1,1-dioxothiolan-3-ol |
| SMILES | CS(=O)(=O)C1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C5H10O5S2/c1-11(7,8)5-3-12(9,10)2-4(5)6/h4-6H,2-3H2,1H3 |
| InChIKey | XLOUZKLQIAFCNQ-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methylsulfonyl-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfonyl-1,1-dioxothiolan-3-ol?
The IUPAC name of 4-methylsulfonyl-1,1-dioxothiolan-3-ol (CID 2736578) is 4-methylsulfonyl-1,1-dioxothiolan-3-ol.
What is the SMILES notation for 4-methylsulfonyl-1,1-dioxothiolan-3-ol?
The canonical SMILES for 4-methylsulfonyl-1,1-dioxothiolan-3-ol is CS(=O)(=O)C1CS(=O)(=O)CC1O.
What is the InChIKey of 4-methylsulfonyl-1,1-dioxothiolan-3-ol?
The InChIKey is XLOUZKLQIAFCNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O5S2/c1-11(7,8)5-3-12(9,10)2-4(5)6/h4-6H,2-3H2,1H3.
What are the key properties of 4-methylsulfonyl-1,1-dioxothiolan-3-ol?
4-methylsulfonyl-1,1-dioxothiolan-3-ol has a molecular weight of 214.26 g/mol, XLogP of -1.81, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfonyl-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 2736578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).