C6ClF9 — CID 2736599
1-chloro-3,3,4,4,5,5-hexafluoro-2-(trifluoromethyl)cyclopentene (PubChem CID 2736599) has the molecular formula C6ClF9 and a molecular weight of 278.50 g/mol. Its IUPAC name is 1-chloro-3,3,4,4,5,5-hexafluoro-2-(trifluoromethyl)cyclopentene.
| Compound Name | 1-chloro-3,3,4,4,5,5-hexafluoro-2-(trifluoromethyl)cyclopentene |
|---|---|
| PubChem CID | 2736599 |
| Molecular Formula | C6ClF9 |
| Molecular Weight | 278.50 g/mol |
| Exact Mass | 277.95 |
| IUPAC Name | 1-chloro-3,3,4,4,5,5-hexafluoro-2-(trifluoromethyl)cyclopentene |
| SMILES | FC(F)(F)C1=C(Cl)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C6ClF9/c7-2-1(5(12,13)14)3(8,9)6(15,16)4(2,10)11 |
| InChIKey | SPJMTEPSABEJSM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|