About 3-sulfanylphenol
3-sulfanylphenol (PubChem CID 2736613) has the molecular formula C6H6OS
and a molecular weight of 126.18 g/mol. Its IUPAC name is 3-sulfanylphenol.
Molecular Properties
| Compound Name | 3-sulfanylphenol |
| PubChem CID | 2736613 |
| Molecular Formula | C6H6OS |
| Molecular Weight | 126.18 g/mol |
| Exact Mass | 126.01 |
| IUPAC Name | 3-sulfanylphenol |
| SMILES | Oc1cccc(S)c1 |
| InChI | InChI=1S/C6H6OS/c7-5-2-1-3-6(8)4-5/h1-4,7-8H |
| InChIKey | DOFIAZGYBIBEGI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-sulfanylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-sulfanylphenol?
The IUPAC name of 3-sulfanylphenol (CID 2736613) is 3-sulfanylphenol.
What is the SMILES notation for 3-sulfanylphenol?
The canonical SMILES for 3-sulfanylphenol is Oc1cccc(S)c1.
What is the InChIKey of 3-sulfanylphenol?
The InChIKey is DOFIAZGYBIBEGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6OS/c7-5-2-1-3-6(8)4-5/h1-4,7-8H.
What are the key properties of 3-sulfanylphenol?
3-sulfanylphenol has a molecular weight of 126.18 g/mol, XLogP of 1.68, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-sulfanylphenol is sourced from PubChem (CID 2736613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).