About 3-methoxycarbonyl-2,2,3-trimethylcyclopentane-1-carboxylic acid
3-methoxycarbonyl-2,2,3-trimethylcyclopentane-1-carboxylic acid (PubChem CID 2736737) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is 3-methoxycarbonyl-2,2,3-trimethylcyclopentane-1-carboxylic acid.
Analyze 3-methoxycarbonyl-2,2,3-trimethylcyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxycarbonyl-2,2,3-trimethylcyclopentane-1-carboxylic acid?
The IUPAC name of 3-methoxycarbonyl-2,2,3-trimethylcyclopentane-1-carboxylic acid (CID 2736737) is 3-methoxycarbonyl-2,2,3-trimethylcyclopentane-1-carboxylic acid.
What is the SMILES notation for 3-methoxycarbonyl-2,2,3-trimethylcyclopentane-1-carboxylic acid?
The canonical SMILES for 3-methoxycarbonyl-2,2,3-trimethylcyclopentane-1-carboxylic acid is COC(=O)C1(C)CCC(C(=O)O)C1(C)C.
What is the InChIKey of 3-methoxycarbonyl-2,2,3-trimethylcyclopentane-1-carboxylic acid?
The InChIKey is CNHMFZIFLREWPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4/c1-10(2)7(8(12)13)5-6-11(10,3)9(14)15-4/h7H,5-6H2,1-4H3,(H,12,13).
What are the key properties of 3-methoxycarbonyl-2,2,3-trimethylcyclopentane-1-carboxylic acid?
3-methoxycarbonyl-2,2,3-trimethylcyclopentane-1-carboxylic acid has a molecular weight of 214.26 g/mol, XLogP of 1.69, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxycarbonyl-2,2,3-trimethylcyclopentane-1-carboxylic acid is sourced from PubChem (CID 2736737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).