About 4,5-difluorobenzene-1,2-diamine
4,5-difluorobenzene-1,2-diamine (PubChem CID 2736755) has the molecular formula C6H6F2N2
and a molecular weight of 144.12 g/mol. Its IUPAC name is 4,5-difluorobenzene-1,2-diamine.
Molecular Properties
| Compound Name | 4,5-difluorobenzene-1,2-diamine |
| PubChem CID | 2736755 |
| Molecular Formula | C6H6F2N2 |
| Molecular Weight | 144.12 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | 4,5-difluorobenzene-1,2-diamine |
| SMILES | Nc1cc(F)c(F)cc1N |
| InChI | InChI=1S/C6H6F2N2/c7-3-1-5(9)6(10)2-4(3)8/h1-2H,9-10H2 |
| InChIKey | PPWRHKISAQTCCG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.12 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4,5-difluorobenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-difluorobenzene-1,2-diamine?
The IUPAC name of 4,5-difluorobenzene-1,2-diamine (CID 2736755) is 4,5-difluorobenzene-1,2-diamine.
What is the SMILES notation for 4,5-difluorobenzene-1,2-diamine?
The canonical SMILES for 4,5-difluorobenzene-1,2-diamine is Nc1cc(F)c(F)cc1N.
What is the InChIKey of 4,5-difluorobenzene-1,2-diamine?
The InChIKey is PPWRHKISAQTCCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6F2N2/c7-3-1-5(9)6(10)2-4(3)8/h1-2H,9-10H2.
What are the key properties of 4,5-difluorobenzene-1,2-diamine?
4,5-difluorobenzene-1,2-diamine has a molecular weight of 144.12 g/mol, XLogP of 1.13, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-difluorobenzene-1,2-diamine is sourced from PubChem (CID 2736755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).