C4HBr2F5O — CID 2736784
1,1-dibromo-3,3,4,4,4-pentafluorobutan-2-one (PubChem CID 2736784) has the molecular formula C4HBr2F5O and a molecular weight of 319.85 g/mol. Its IUPAC name is 1,1-dibromo-3,3,4,4,4-pentafluorobutan-2-one.
| Compound Name | 1,1-dibromo-3,3,4,4,4-pentafluorobutan-2-one |
|---|---|
| PubChem CID | 2736784 |
| Molecular Formula | C4HBr2F5O |
| Molecular Weight | 319.85 g/mol |
| Exact Mass | 317.83 |
| IUPAC Name | 1,1-dibromo-3,3,4,4,4-pentafluorobutan-2-one |
| SMILES | O=C(C(Br)Br)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4HBr2F5O/c5-2(6)1(12)3(7,8)4(9,10)11/h2H |
| InChIKey | OJSMVZNNJAOBLZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.85 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|