About 2,6-ditert-butyl-4-methylpyrylium;trifluoromethanesulfonate
2,6-ditert-butyl-4-methylpyrylium;trifluoromethanesulfonate (PubChem CID 2736809) has the molecular formula C15H23F3O4S
and a molecular weight of 356.41 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-methylpyrylium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 2,6-ditert-butyl-4-methylpyrylium;trifluoromethanesulfonate |
| PubChem CID | 2736809 |
| Molecular Formula | C15H23F3O4S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 2,6-ditert-butyl-4-methylpyrylium;trifluoromethanesulfonate |
| SMILES | Cc1cc(C(C)(C)C)[o+]c(C(C)(C)C)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C14H23O.CHF3O3S/c1-10-8-11(13(2,3)4)15-12(9-10)14(5,6)7;2-1(3,4)8(5,6)7/h8-9H,1-7H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | OTVABNVGYCQZFO-UHFFFAOYSA-M |
| XLogP | 4.52 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 2,6-ditert-butyl-4-methylpyrylium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-ditert-butyl-4-methylpyrylium;trifluoromethanesulfonate?
The IUPAC name of 2,6-ditert-butyl-4-methylpyrylium;trifluoromethanesulfonate (CID 2736809) is 2,6-ditert-butyl-4-methylpyrylium;trifluoromethanesulfonate.
What is the SMILES notation for 2,6-ditert-butyl-4-methylpyrylium;trifluoromethanesulfonate?
The canonical SMILES for 2,6-ditert-butyl-4-methylpyrylium;trifluoromethanesulfonate is Cc1cc(C(C)(C)C)[o+]c(C(C)(C)C)c1.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of 2,6-ditert-butyl-4-methylpyrylium;trifluoromethanesulfonate?
The InChIKey is OTVABNVGYCQZFO-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H23O.CHF3O3S/c1-10-8-11(13(2,3)4)15-12(9-10)14(5,6)7;2-1(3,4)8(5,6)7/h8-9H,1-7H3;(H,5,6,7)/q+1;/p-1.
What are the key properties of 2,6-ditert-butyl-4-methylpyrylium;trifluoromethanesulfonate?
2,6-ditert-butyl-4-methylpyrylium;trifluoromethanesulfonate has a molecular weight of 356.41 g/mol, XLogP of 4.52, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-ditert-butyl-4-methylpyrylium;trifluoromethanesulfonate is sourced from PubChem (CID 2736809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).