About (Z)-1,2-dichloro-1,2-difluoroethene
(Z)-1,2-dichloro-1,2-difluoroethene (PubChem CID 2736814) has the molecular formula C2Cl2F2
and a molecular weight of 132.92 g/mol. Its IUPAC name is (Z)-1,2-dichloro-1,2-difluoroethene.
Molecular Properties
| Compound Name | (Z)-1,2-dichloro-1,2-difluoroethene |
| PubChem CID | 2736814 |
| Molecular Formula | C2Cl2F2 |
| Molecular Weight | 132.92 g/mol |
| Exact Mass | 131.93 |
| IUPAC Name | (Z)-1,2-dichloro-1,2-difluoroethene |
| SMILES | F/C(Cl)=C(\F)Cl |
| InChI | InChI=1S/C2Cl2F2/c3-1(5)2(4)6/b2-1- |
| InChIKey | UPVJEODAZWTJKZ-UPHRSURJSA-N |
| XLogP | 2.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.92 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (Z)-1,2-dichloro-1,2-difluoroethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,2-dichloro-1,2-difluoroethene?
The IUPAC name of (Z)-1,2-dichloro-1,2-difluoroethene (CID 2736814) is (Z)-1,2-dichloro-1,2-difluoroethene.
What is the SMILES notation for (Z)-1,2-dichloro-1,2-difluoroethene?
The canonical SMILES for (Z)-1,2-dichloro-1,2-difluoroethene is F/C(Cl)=C(\F)Cl.
What is the InChIKey of (Z)-1,2-dichloro-1,2-difluoroethene?
The InChIKey is UPVJEODAZWTJKZ-UPHRSURJSA-N. The full InChI is InChI=1S/C2Cl2F2/c3-1(5)2(4)6/b2-1-.
What are the key properties of (Z)-1,2-dichloro-1,2-difluoroethene?
(Z)-1,2-dichloro-1,2-difluoroethene has a molecular weight of 132.92 g/mol, XLogP of 2.53, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,2-dichloro-1,2-difluoroethene is sourced from PubChem (CID 2736814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).