C10H8N2O2 — CID 2736908
2-methyl-1,8-naphthyridine-3-carboxylic acid (PubChem CID 2736908) has the molecular formula C10H8N2O2 and a molecular weight of 188.19 g/mol. Its IUPAC name is 2-methyl-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 2-methyl-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 2736908 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 2-methyl-1,8-naphthyridine-3-carboxylic acid |
| SMILES | Cc1nc2ncccc2cc1C(=O)O |
| InChI | InChI=1S/C10H8N2O2/c1-6-8(10(13)14)5-7-3-2-4-11-9(7)12-6/h2-5H,1H3,(H,13,14) |
| InChIKey | STQOBEMCYUGNTL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |