About 8-methyl-3-oxido-[1,2,5]oxadiazolo[3,4-f]cinnolin-3-ium
8-methyl-3-oxido-[1,2,5]oxadiazolo[3,4-f]cinnolin-3-ium (PubChem CID 2736920) has the molecular formula C9H6N4O2
and a molecular weight of 202.17 g/mol. Its IUPAC name is 8-methyl-3-oxido-[1,2,5]oxadiazolo[3,4-f]cinnolin-3-ium.
Molecular Properties
| Compound Name | 8-methyl-3-oxido-[1,2,5]oxadiazolo[3,4-f]cinnolin-3-ium |
| PubChem CID | 2736920 |
| Molecular Formula | C9H6N4O2 |
| Molecular Weight | 202.17 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 8-methyl-3-oxido-[1,2,5]oxadiazolo[3,4-f]cinnolin-3-ium |
| SMILES | Cc1cc2c(ccc3c2no[n+]3[O-])nn1 |
| InChI | InChI=1S/C9H6N4O2/c1-5-4-6-7(11-10-5)2-3-8-9(6)12-15-13(8)14/h2-4H,1H3 |
| InChIKey | MKUGOLLPGZDMOE-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 78.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.17 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-3-oxido-[1,2,5]oxadiazolo[3,4-f]cinnolin-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-3-oxido-[1,2,5]oxadiazolo[3,4-f]cinnolin-3-ium?
The IUPAC name of 8-methyl-3-oxido-[1,2,5]oxadiazolo[3,4-f]cinnolin-3-ium (CID 2736920) is 8-methyl-3-oxido-[1,2,5]oxadiazolo[3,4-f]cinnolin-3-ium.
What is the SMILES notation for 8-methyl-3-oxido-[1,2,5]oxadiazolo[3,4-f]cinnolin-3-ium?
The canonical SMILES for 8-methyl-3-oxido-[1,2,5]oxadiazolo[3,4-f]cinnolin-3-ium is Cc1cc2c(ccc3c2no[n+]3[O-])nn1.
What is the InChIKey of 8-methyl-3-oxido-[1,2,5]oxadiazolo[3,4-f]cinnolin-3-ium?
The InChIKey is MKUGOLLPGZDMOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N4O2/c1-5-4-6-7(11-10-5)2-3-8-9(6)12-15-13(8)14/h2-4H,1H3.
What are the key properties of 8-methyl-3-oxido-[1,2,5]oxadiazolo[3,4-f]cinnolin-3-ium?
8-methyl-3-oxido-[1,2,5]oxadiazolo[3,4-f]cinnolin-3-ium has a molecular weight of 202.17 g/mol, XLogP of 0.71, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-3-oxido-[1,2,5]oxadiazolo[3,4-f]cinnolin-3-ium is sourced from PubChem (CID 2736920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).