About 2,2-difluoro-1,3-benzodioxole-5-carbonitrile
2,2-difluoro-1,3-benzodioxole-5-carbonitrile (PubChem CID 2736962) has the molecular formula C8H3F2NO2
and a molecular weight of 183.11 g/mol. Its IUPAC name is 2,2-difluoro-1,3-benzodioxole-5-carbonitrile.
Molecular Properties
| Compound Name | 2,2-difluoro-1,3-benzodioxole-5-carbonitrile |
| PubChem CID | 2736962 |
| Molecular Formula | C8H3F2NO2 |
| Molecular Weight | 183.11 g/mol |
| Exact Mass | 183.01 |
| IUPAC Name | 2,2-difluoro-1,3-benzodioxole-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C8H3F2NO2/c9-8(10)12-6-2-1-5(4-11)3-7(6)13-8/h1-3H |
| InChIKey | VMJNTFXCTXAXTC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.11 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-difluoro-1,3-benzodioxole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-1,3-benzodioxole-5-carbonitrile?
The IUPAC name of 2,2-difluoro-1,3-benzodioxole-5-carbonitrile (CID 2736962) is 2,2-difluoro-1,3-benzodioxole-5-carbonitrile.
What is the SMILES notation for 2,2-difluoro-1,3-benzodioxole-5-carbonitrile?
The canonical SMILES for 2,2-difluoro-1,3-benzodioxole-5-carbonitrile is N#Cc1ccc2c(c1)OC(F)(F)O2.
What is the InChIKey of 2,2-difluoro-1,3-benzodioxole-5-carbonitrile?
The InChIKey is VMJNTFXCTXAXTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3F2NO2/c9-8(10)12-6-2-1-5(4-11)3-7(6)13-8/h1-3H.
What are the key properties of 2,2-difluoro-1,3-benzodioxole-5-carbonitrile?
2,2-difluoro-1,3-benzodioxole-5-carbonitrile has a molecular weight of 183.11 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-1,3-benzodioxole-5-carbonitrile is sourced from PubChem (CID 2736962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).