About 5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonyl chloride
5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonyl chloride (PubChem CID 2736979) has the molecular formula C8H6ClNO2S3
and a molecular weight of 279.80 g/mol. Its IUPAC name is 5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonyl chloride.
Molecular Properties
| Compound Name | 5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonyl chloride |
| PubChem CID | 2736979 |
| Molecular Formula | C8H6ClNO2S3 |
| Molecular Weight | 279.80 g/mol |
| Exact Mass | 278.92 |
| IUPAC Name | 5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonyl chloride |
| SMILES | Cc1nc(-c2ccc(S(=O)(=O)Cl)s2)cs1 |
| InChI | InChI=1S/C8H6ClNO2S3/c1-5-10-6(4-13-5)7-2-3-8(14-7)15(9,11)12/h2-4H,1H3 |
| InChIKey | YIKNRCVJBOLZFL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.80 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonyl chloride?
The IUPAC name of 5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonyl chloride (CID 2736979) is 5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonyl chloride.
What is the SMILES notation for 5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonyl chloride?
The canonical SMILES for 5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonyl chloride is Cc1nc(-c2ccc(S(=O)(=O)Cl)s2)cs1.
What is the InChIKey of 5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonyl chloride?
The InChIKey is YIKNRCVJBOLZFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClNO2S3/c1-5-10-6(4-13-5)7-2-3-8(14-7)15(9,11)12/h2-4H,1H3.
What are the key properties of 5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonyl chloride?
5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonyl chloride has a molecular weight of 279.80 g/mol, XLogP of 3.11, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-sulfonyl chloride is sourced from PubChem (CID 2736979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).