C9H8F2O2 — CID 2736983
1-(3,5-difluoro-4-methoxyphenyl)ethanone (PubChem CID 2736983) has the molecular formula C9H8F2O2 and a molecular weight of 186.16 g/mol. Its IUPAC name is 1-(3,5-difluoro-4-methoxyphenyl)ethanone.
| Compound Name | 1-(3,5-difluoro-4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 2736983 |
| Molecular Formula | C9H8F2O2 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 1-(3,5-difluoro-4-methoxyphenyl)ethanone |
| SMILES | COc1c(F)cc(C(C)=O)cc1F |
| InChI | InChI=1S/C9H8F2O2/c1-5(12)6-3-7(10)9(13-2)8(11)4-6/h3-4H,1-2H3 |
| InChIKey | OUJZNFJFMAKGMS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |