C21H26BrN3O3 — CID 27369839
5-bromo-N-[(2S)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-morpholin-4-ylethyl]furan-2-carboxamide (PubChem CID 27369839) has the molecular formula C21H26BrN3O3 and a molecular weight of 448.36 g/mol. Its IUPAC name is 5-bromo-N-[(2S)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-morpholin-4-ylethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[(2S)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-morpholin-4-ylethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 27369839 |
| Molecular Formula | C21H26BrN3O3 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 5-bromo-N-[(2S)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-morpholin-4-ylethyl]furan-2-carboxamide |
| SMILES | CN1CCCc2cc([C@@H](CNC(=O)c3ccc(Br)o3)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C21H26BrN3O3/c1-24-8-2-3-15-13-16(4-5-17(15)24)18(25-9-11-27-12-10-25)14-23-21(26)19-6-7-20(22)28-19/h4-7,13,18H,2-3,8-12,14H2,1H3,(H,23,26)/t18-/m1/s1 |
| InChIKey | ZZYLPXGWIWDADH-GOSISDBHSA-N |
| XLogP | 3.23 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|