C7H13N3O2S — CID 27370881
2-(3,5-dimethyl-4-sulfanylidene-1,3,5-triazinan-1-ium-1-yl)acetate (PubChem CID 27370881) has the molecular formula C7H13N3O2S and a molecular weight of 203.27 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-sulfanylidene-1,3,5-triazinan-1-ium-1-yl)acetate.
| Compound Name | 2-(3,5-dimethyl-4-sulfanylidene-1,3,5-triazinan-1-ium-1-yl)acetate |
|---|---|
| PubChem CID | 27370881 |
| Molecular Formula | C7H13N3O2S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 2-(3,5-dimethyl-4-sulfanylidene-1,3,5-triazinan-1-ium-1-yl)acetate |
| SMILES | CN1C[NH+](CC(=O)[O-])CN(C)C1=S |
| InChI | InChI=1S/C7H13N3O2S/c1-8-4-10(3-6(11)12)5-9(2)7(8)13/h3-5H2,1-2H3,(H,11,12) |
| InChIKey | PDLFTVZIYBEACZ-UHFFFAOYSA-N |
| XLogP | -3.30 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|