About 6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one
6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one (PubChem CID 2737092) has the molecular formula C9H6F3NOS
and a molecular weight of 233.21 g/mol. Its IUPAC name is 6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one |
| PubChem CID | 2737092 |
| Molecular Formula | C9H6F3NOS |
| Molecular Weight | 233.21 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | 6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1CSc2ccc(C(F)(F)F)cc2N1 |
| InChI | InChI=1S/C9H6F3NOS/c10-9(11,12)5-1-2-7-6(3-5)13-8(14)4-15-7/h1-3H,4H2,(H,13,14) |
| InChIKey | CDCYQWJTDZXFCS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one?
The IUPAC name of 6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one (CID 2737092) is 6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one.
What is the SMILES notation for 6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one?
The canonical SMILES for 6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one is O=C1CSc2ccc(C(F)(F)F)cc2N1.
What is the InChIKey of 6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one?
The InChIKey is CDCYQWJTDZXFCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F3NOS/c10-9(11,12)5-1-2-7-6(3-5)13-8(14)4-15-7/h1-3H,4H2,(H,13,14).
What are the key properties of 6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one?
6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one has a molecular weight of 233.21 g/mol, XLogP of 2.75, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one is sourced from PubChem (CID 2737092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).