C13H17N3S — CID 2737110
5-(4-pentylphenyl)-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 2737110) has the molecular formula C13H17N3S and a molecular weight of 247.37 g/mol. Its IUPAC name is 5-(4-pentylphenyl)-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-(4-pentylphenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 2737110 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 5-(4-pentylphenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | CCCCCc1ccc(-c2nc(=S)[nH][nH]2)cc1 |
| InChI | InChI=1S/C13H17N3S/c1-2-3-4-5-10-6-8-11(9-7-10)12-14-13(17)16-15-12/h6-9H,2-5H2,1H3,(H2,14,15,16,17) |
| InChIKey | QJXDYMISGLBANE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|