About diphenyliodanium;hexafluoroarsenic(1-)
diphenyliodanium;hexafluoroarsenic(1-) (PubChem CID 2737135) has the molecular formula C12H10AsF6I
and a molecular weight of 470.03 g/mol. Its IUPAC name is diphenyliodanium;hexafluoroarsenic(1-).
Molecular Properties
| Compound Name | diphenyliodanium;hexafluoroarsenic(1-) |
| PubChem CID | 2737135 |
| Molecular Formula | C12H10AsF6I |
| Molecular Weight | 470.03 g/mol |
| Exact Mass | 469.89 |
| IUPAC Name | diphenyliodanium;hexafluoroarsenic(1-) |
| SMILES | F[As-](F)(F)(F)(F)F.c1ccc([I+]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10I.AsF6/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2-1(3,4,5,6)7/h1-10H;/q+1;-1 |
| InChIKey | KFGZTBBPOZNSHA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.03 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze diphenyliodanium;hexafluoroarsenic(1-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyliodanium;hexafluoroarsenic(1-)?
The IUPAC name of diphenyliodanium;hexafluoroarsenic(1-) (CID 2737135) is diphenyliodanium;hexafluoroarsenic(1-).
What is the SMILES notation for diphenyliodanium;hexafluoroarsenic(1-)?
The canonical SMILES for diphenyliodanium;hexafluoroarsenic(1-) is F[As-](F)(F)(F)(F)F.c1ccc([I+]c2ccccc2)cc1.
What is the InChIKey of diphenyliodanium;hexafluoroarsenic(1-)?
The InChIKey is KFGZTBBPOZNSHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10I.AsF6/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2-1(3,4,5,6)7/h1-10H;/q+1;-1.
What are the key properties of diphenyliodanium;hexafluoroarsenic(1-)?
diphenyliodanium;hexafluoroarsenic(1-) has a molecular weight of 470.03 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyliodanium;hexafluoroarsenic(1-) is sourced from PubChem (CID 2737135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).