About diphenyliodanium;trifluoromethanesulfonate
diphenyliodanium;trifluoromethanesulfonate (PubChem CID 2737137) has the molecular formula C13H10F3IO3S
and a molecular weight of 430.19 g/mol. Its IUPAC name is diphenyliodanium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | diphenyliodanium;trifluoromethanesulfonate |
| PubChem CID | 2737137 |
| Molecular Formula | C13H10F3IO3S |
| Molecular Weight | 430.19 g/mol |
| Exact Mass | 429.93 |
| IUPAC Name | diphenyliodanium;trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.c1ccc([I+]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10I.CHF3O3S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2-1(3,4)8(5,6)7/h1-10H;(H,5,6,7)/q+1;/p-1 |
| InChIKey | SBQIJPBUMNWUKN-UHFFFAOYSA-M |
| XLogP | -0.13 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.19 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze diphenyliodanium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyliodanium;trifluoromethanesulfonate?
The IUPAC name of diphenyliodanium;trifluoromethanesulfonate (CID 2737137) is diphenyliodanium;trifluoromethanesulfonate.
What is the SMILES notation for diphenyliodanium;trifluoromethanesulfonate?
The canonical SMILES for diphenyliodanium;trifluoromethanesulfonate is O=S(=O)([O-])C(F)(F)F.c1ccc([I+]c2ccccc2)cc1.
What is the InChIKey of diphenyliodanium;trifluoromethanesulfonate?
The InChIKey is SBQIJPBUMNWUKN-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H10I.CHF3O3S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2-1(3,4)8(5,6)7/h1-10H;(H,5,6,7)/q+1;/p-1.
What are the key properties of diphenyliodanium;trifluoromethanesulfonate?
diphenyliodanium;trifluoromethanesulfonate has a molecular weight of 430.19 g/mol, XLogP of -0.13, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyliodanium;trifluoromethanesulfonate is sourced from PubChem (CID 2737137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).