2-phenylimidazo[1,2-a]pyridine-3-carboxylic acid

C14H10N2O2 — CID 2737144

IUPAC2-phenylimidazo[1,2-a]pyridine-3-carboxylic acid
SMILESO=C(O)c1c(-c2ccccc2)nc2ccccn12
InChIInChI=1S/C14H10N2O2/c17-14(18)13-12(10-6-2-1-3-7-10)15-11-8-4-5-9-16(11)13/h1-9H,(H,17,18)
InChIKeyWJWJFXUNWPMQSU-UHFFFAOYSA-N
MW238.25 g/mol
LogP2.70
Rot. Bonds2

About 2-phenylimidazo[1,2-a]pyridine-3-carboxylic acid

2-phenylimidazo[1,2-a]pyridine-3-carboxylic acid (PubChem CID 2737144) has the molecular formula C14H10N2O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is 2-phenylimidazo[1,2-a]pyridine-3-carboxylic acid.

Molecular Properties

Compound Name2-phenylimidazo[1,2-a]pyridine-3-carboxylic acid
PubChem CID2737144
Molecular FormulaC14H10N2O2
Molecular Weight238.25 g/mol
Exact Mass238.07
IUPAC Name2-phenylimidazo[1,2-a]pyridine-3-carboxylic acid
SMILESO=C(O)c1c(-c2ccccc2)nc2ccccn12
InChIInChI=1S/C14H10N2O2/c17-14(18)13-12(10-6-2-1-3-7-10)15-11-8-4-5-9-16(11)13/h1-9H,(H,17,18)
InChIKeyWJWJFXUNWPMQSU-UHFFFAOYSA-N
XLogP2.70
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.25
LogP ≤ 52.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-phenylimidazo[1,2-a]pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-phenylimidazo[1,2-a]pyridine-3-carboxylic acid?
The IUPAC name of 2-phenylimidazo[1,2-a]pyridine-3-carboxylic acid (CID 2737144) is 2-phenylimidazo[1,2-a]pyridine-3-carboxylic acid.
What is the SMILES notation for 2-phenylimidazo[1,2-a]pyridine-3-carboxylic acid?
The canonical SMILES for 2-phenylimidazo[1,2-a]pyridine-3-carboxylic acid is O=C(O)c1c(-c2ccccc2)nc2ccccn12.
What is the InChIKey of 2-phenylimidazo[1,2-a]pyridine-3-carboxylic acid?
The InChIKey is WJWJFXUNWPMQSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O2/c17-14(18)13-12(10-6-2-1-3-7-10)15-11-8-4-5-9-16(11)13/h1-9H,(H,17,18).
What are the key properties of 2-phenylimidazo[1,2-a]pyridine-3-carboxylic acid?
2-phenylimidazo[1,2-a]pyridine-3-carboxylic acid has a molecular weight of 238.25 g/mol, XLogP of 2.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylimidazo[1,2-a]pyridine-3-carboxylic acid is sourced from PubChem (CID 2737144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).