C24H23N5O3S — CID 27371706
ethyl 4-[[1-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)piperidine-4-carbonyl]amino]benzoate (PubChem CID 27371706) has the molecular formula C24H23N5O3S and a molecular weight of 461.55 g/mol. Its IUPAC name is ethyl 4-[[1-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)piperidine-4-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[1-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)piperidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 27371706 |
| Molecular Formula | C24H23N5O3S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | ethyl 4-[[1-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)piperidine-4-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C2CCN(c3ncnc4c3sc3ncccc34)CC2)cc1 |
| InChI | InChI=1S/C24H23N5O3S/c1-2-32-24(31)16-5-7-17(8-6-16)28-22(30)15-9-12-29(13-10-15)21-20-19(26-14-27-21)18-4-3-11-25-23(18)33-20/h3-8,11,14-15H,2,9-10,12-13H2,1H3,(H,28,30) |
| InChIKey | XPIMVDPFRFFOSI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |