About 2-ethyl-4-fluorophenol
2-ethyl-4-fluorophenol (PubChem CID 2737185) has the molecular formula C8H9FO
and a molecular weight of 140.16 g/mol. Its IUPAC name is 2-ethyl-4-fluorophenol.
Molecular Properties
| Compound Name | 2-ethyl-4-fluorophenol |
| PubChem CID | 2737185 |
| Molecular Formula | C8H9FO |
| Molecular Weight | 140.16 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 2-ethyl-4-fluorophenol |
| SMILES | CCc1cc(F)ccc1O |
| InChI | InChI=1S/C8H9FO/c1-2-6-5-7(9)3-4-8(6)10/h3-5,10H,2H2,1H3 |
| InChIKey | JKZWRPGOAAMNQY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.16 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-4-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-fluorophenol?
The IUPAC name of 2-ethyl-4-fluorophenol (CID 2737185) is 2-ethyl-4-fluorophenol.
What is the SMILES notation for 2-ethyl-4-fluorophenol?
The canonical SMILES for 2-ethyl-4-fluorophenol is CCc1cc(F)ccc1O.
What is the InChIKey of 2-ethyl-4-fluorophenol?
The InChIKey is JKZWRPGOAAMNQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FO/c1-2-6-5-7(9)3-4-8(6)10/h3-5,10H,2H2,1H3.
What are the key properties of 2-ethyl-4-fluorophenol?
2-ethyl-4-fluorophenol has a molecular weight of 140.16 g/mol, XLogP of 2.09, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-fluorophenol is sourced from PubChem (CID 2737185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).