About 1-ethoxy-1,2,2-trifluoroethene
1-ethoxy-1,2,2-trifluoroethene (PubChem CID 2737241) has the molecular formula C4H5F3O
and a molecular weight of 126.08 g/mol. Its IUPAC name is 1-ethoxy-1,2,2-trifluoroethene.
Molecular Properties
| Compound Name | 1-ethoxy-1,2,2-trifluoroethene |
| PubChem CID | 2737241 |
| Molecular Formula | C4H5F3O |
| Molecular Weight | 126.08 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | 1-ethoxy-1,2,2-trifluoroethene |
| SMILES | CCOC(F)=C(F)F |
| InChI | InChI=1S/C4H5F3O/c1-2-8-4(7)3(5)6/h2H2,1H3 |
| InChIKey | OTKFYPFFYGHATK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.08 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxy-1,2,2-trifluoroethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-1,2,2-trifluoroethene?
The IUPAC name of 1-ethoxy-1,2,2-trifluoroethene (CID 2737241) is 1-ethoxy-1,2,2-trifluoroethene.
What is the SMILES notation for 1-ethoxy-1,2,2-trifluoroethene?
The canonical SMILES for 1-ethoxy-1,2,2-trifluoroethene is CCOC(F)=C(F)F.
What is the InChIKey of 1-ethoxy-1,2,2-trifluoroethene?
The InChIKey is OTKFYPFFYGHATK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5F3O/c1-2-8-4(7)3(5)6/h2H2,1H3.
What are the key properties of 1-ethoxy-1,2,2-trifluoroethene?
1-ethoxy-1,2,2-trifluoroethene has a molecular weight of 126.08 g/mol, XLogP of 2.06, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-1,2,2-trifluoroethene is sourced from PubChem (CID 2737241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).