4-pyrrol-1-ylbenzoic acid

C11H9NO2 — CID 2737256

IUPAC4-pyrrol-1-ylbenzoic acid
SMILESO=C(O)c1ccc(-n2cccc2)cc1
InChIInChI=1S/C11H9NO2/c13-11(14)9-3-5-10(6-4-9)12-7-1-2-8-12/h1-8H,(H,13,14)
InChIKeyNLSIIPKSANRIGS-UHFFFAOYSA-N
MW187.20 g/mol
LogP2.18
Rot. Bonds2

About 4-pyrrol-1-ylbenzoic acid

4-pyrrol-1-ylbenzoic acid (PubChem CID 2737256) has the molecular formula C11H9NO2 and a molecular weight of 187.20 g/mol. Its IUPAC name is 4-pyrrol-1-ylbenzoic acid.

Molecular Properties

Compound Name4-pyrrol-1-ylbenzoic acid
PubChem CID2737256
Molecular FormulaC11H9NO2
Molecular Weight187.20 g/mol
Exact Mass187.06
IUPAC Name4-pyrrol-1-ylbenzoic acid
SMILESO=C(O)c1ccc(-n2cccc2)cc1
InChIInChI=1S/C11H9NO2/c13-11(14)9-3-5-10(6-4-9)12-7-1-2-8-12/h1-8H,(H,13,14)
InChIKeyNLSIIPKSANRIGS-UHFFFAOYSA-N
XLogP2.18
TPSA42.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.20
LogP ≤ 52.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-pyrrol-1-ylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-pyrrol-1-ylbenzoic acid?
The IUPAC name of 4-pyrrol-1-ylbenzoic acid (CID 2737256) is 4-pyrrol-1-ylbenzoic acid.
What is the SMILES notation for 4-pyrrol-1-ylbenzoic acid?
The canonical SMILES for 4-pyrrol-1-ylbenzoic acid is O=C(O)c1ccc(-n2cccc2)cc1.
What is the InChIKey of 4-pyrrol-1-ylbenzoic acid?
The InChIKey is NLSIIPKSANRIGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2/c13-11(14)9-3-5-10(6-4-9)12-7-1-2-8-12/h1-8H,(H,13,14).
What are the key properties of 4-pyrrol-1-ylbenzoic acid?
4-pyrrol-1-ylbenzoic acid has a molecular weight of 187.20 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyrrol-1-ylbenzoic acid is sourced from PubChem (CID 2737256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).