C26H28N4O2S — CID 27372712
2-[2-(2-butoxyphenyl)pyrazolo[1,5-a]pyrazin-4-yl]sulfanyl-N-(2,6-dimethylphenyl)acetamide (PubChem CID 27372712) has the molecular formula C26H28N4O2S and a molecular weight of 460.60 g/mol. Its IUPAC name is 2-[2-(2-butoxyphenyl)pyrazolo[1,5-a]pyrazin-4-yl]sulfanyl-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-[2-(2-butoxyphenyl)pyrazolo[1,5-a]pyrazin-4-yl]sulfanyl-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 27372712 |
| Molecular Formula | C26H28N4O2S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 2-[2-(2-butoxyphenyl)pyrazolo[1,5-a]pyrazin-4-yl]sulfanyl-N-(2,6-dimethylphenyl)acetamide |
| SMILES | CCCCOc1ccccc1-c1cc2c(SCC(=O)Nc3c(C)cccc3C)nccn2n1 |
| InChI | InChI=1S/C26H28N4O2S/c1-4-5-15-32-23-12-7-6-11-20(23)21-16-22-26(27-13-14-30(22)29-21)33-17-24(31)28-25-18(2)9-8-10-19(25)3/h6-14,16H,4-5,15,17H2,1-3H3,(H,28,31) |
| InChIKey | BFOZGSSIYSSFOR-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|