C20H14ClFN4O2 — CID 27372860
3-benzyl-1-[(2-chloro-6-fluorophenyl)methyl]pteridine-2,4-dione (PubChem CID 27372860) has the molecular formula C20H14ClFN4O2 and a molecular weight of 396.81 g/mol. Its IUPAC name is 3-benzyl-1-[(2-chloro-6-fluorophenyl)methyl]pteridine-2,4-dione.
| Compound Name | 3-benzyl-1-[(2-chloro-6-fluorophenyl)methyl]pteridine-2,4-dione |
|---|---|
| PubChem CID | 27372860 |
| Molecular Formula | C20H14ClFN4O2 |
| Molecular Weight | 396.81 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 3-benzyl-1-[(2-chloro-6-fluorophenyl)methyl]pteridine-2,4-dione |
| SMILES | O=c1c2nccnc2n(Cc2c(F)cccc2Cl)c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C20H14ClFN4O2/c21-15-7-4-8-16(22)14(15)12-25-18-17(23-9-10-24-18)19(27)26(20(25)28)11-13-5-2-1-3-6-13/h1-10H,11-12H2 |
| InChIKey | ODCCIZMNBUGNMV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.81 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |