About 1-[(2,5-dimethylphenyl)methyl]-3-[(4-methoxyphenyl)methyl]pteridine-2,4-dione
1-[(2,5-dimethylphenyl)methyl]-3-[(4-methoxyphenyl)methyl]pteridine-2,4-dione (PubChem CID 27372861) has the molecular formula C23H22N4O3
and a molecular weight of 402.45 g/mol. Its IUPAC name is 1-[(2,5-dimethylphenyl)methyl]-3-[(4-methoxyphenyl)methyl]pteridine-2,4-dione.
Molecular Properties
| Compound Name | 1-[(2,5-dimethylphenyl)methyl]-3-[(4-methoxyphenyl)methyl]pteridine-2,4-dione |
| PubChem CID | 27372861 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-[(2,5-dimethylphenyl)methyl]-3-[(4-methoxyphenyl)methyl]pteridine-2,4-dione |
| SMILES | COc1ccc(Cn2c(=O)c3nccnc3n(Cc3cc(C)ccc3C)c2=O)cc1 |
| InChI | InChI=1S/C23H22N4O3/c1-15-4-5-16(2)18(12-15)14-26-21-20(24-10-11-25-21)22(28)27(23(26)29)13-17-6-8-19(30-3)9-7-17/h4-12H,13-14H2,1-3H3 |
| InChIKey | SDFSDGZTSRWZIR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 79.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[(2,5-dimethylphenyl)methyl]-3-[(4-methoxyphenyl)methyl]pteridine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,5-dimethylphenyl)methyl]-3-[(4-methoxyphenyl)methyl]pteridine-2,4-dione?
The IUPAC name of 1-[(2,5-dimethylphenyl)methyl]-3-[(4-methoxyphenyl)methyl]pteridine-2,4-dione (CID 27372861) is 1-[(2,5-dimethylphenyl)methyl]-3-[(4-methoxyphenyl)methyl]pteridine-2,4-dione.
What is the SMILES notation for 1-[(2,5-dimethylphenyl)methyl]-3-[(4-methoxyphenyl)methyl]pteridine-2,4-dione?
The canonical SMILES for 1-[(2,5-dimethylphenyl)methyl]-3-[(4-methoxyphenyl)methyl]pteridine-2,4-dione is COc1ccc(Cn2c(=O)c3nccnc3n(Cc3cc(C)ccc3C)c2=O)cc1.
What is the InChIKey of 1-[(2,5-dimethylphenyl)methyl]-3-[(4-methoxyphenyl)methyl]pteridine-2,4-dione?
The InChIKey is SDFSDGZTSRWZIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N4O3/c1-15-4-5-16(2)18(12-15)14-26-21-20(24-10-11-25-21)22(28)27(23(26)29)13-17-6-8-19(30-3)9-7-17/h4-12H,13-14H2,1-3H3.
What are the key properties of 1-[(2,5-dimethylphenyl)methyl]-3-[(4-methoxyphenyl)methyl]pteridine-2,4-dione?
1-[(2,5-dimethylphenyl)methyl]-3-[(4-methoxyphenyl)methyl]pteridine-2,4-dione has a molecular weight of 402.45 g/mol, XLogP of 2.68, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,5-dimethylphenyl)methyl]-3-[(4-methoxyphenyl)methyl]pteridine-2,4-dione is sourced from PubChem (CID 27372861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).