About 4-[(2,5-dimethylphenyl)methylsulfanyl]-2-thiophen-2-ylpyrazolo[1,5-a]pyrazine
4-[(2,5-dimethylphenyl)methylsulfanyl]-2-thiophen-2-ylpyrazolo[1,5-a]pyrazine (PubChem CID 27373094) has the molecular formula C19H17N3S2
and a molecular weight of 351.50 g/mol. Its IUPAC name is 4-[(2,5-dimethylphenyl)methylsulfanyl]-2-thiophen-2-ylpyrazolo[1,5-a]pyrazine.
Molecular Properties
| Compound Name | 4-[(2,5-dimethylphenyl)methylsulfanyl]-2-thiophen-2-ylpyrazolo[1,5-a]pyrazine |
| PubChem CID | 27373094 |
| Molecular Formula | C19H17N3S2 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 4-[(2,5-dimethylphenyl)methylsulfanyl]-2-thiophen-2-ylpyrazolo[1,5-a]pyrazine |
| SMILES | Cc1ccc(C)c(CSc2nccn3nc(-c4cccs4)cc23)c1 |
| InChI | InChI=1S/C19H17N3S2/c1-13-5-6-14(2)15(10-13)12-24-19-17-11-16(18-4-3-9-23-18)21-22(17)8-7-20-19/h3-11H,12H2,1-2H3 |
| InChIKey | FUIYDPNMJPPWQC-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2,5-dimethylphenyl)methylsulfanyl]-2-thiophen-2-ylpyrazolo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,5-dimethylphenyl)methylsulfanyl]-2-thiophen-2-ylpyrazolo[1,5-a]pyrazine?
The IUPAC name of 4-[(2,5-dimethylphenyl)methylsulfanyl]-2-thiophen-2-ylpyrazolo[1,5-a]pyrazine (CID 27373094) is 4-[(2,5-dimethylphenyl)methylsulfanyl]-2-thiophen-2-ylpyrazolo[1,5-a]pyrazine.
What is the SMILES notation for 4-[(2,5-dimethylphenyl)methylsulfanyl]-2-thiophen-2-ylpyrazolo[1,5-a]pyrazine?
The canonical SMILES for 4-[(2,5-dimethylphenyl)methylsulfanyl]-2-thiophen-2-ylpyrazolo[1,5-a]pyrazine is Cc1ccc(C)c(CSc2nccn3nc(-c4cccs4)cc23)c1.
What is the InChIKey of 4-[(2,5-dimethylphenyl)methylsulfanyl]-2-thiophen-2-ylpyrazolo[1,5-a]pyrazine?
The InChIKey is FUIYDPNMJPPWQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3S2/c1-13-5-6-14(2)15(10-13)12-24-19-17-11-16(18-4-3-9-23-18)21-22(17)8-7-20-19/h3-11H,12H2,1-2H3.
What are the key properties of 4-[(2,5-dimethylphenyl)methylsulfanyl]-2-thiophen-2-ylpyrazolo[1,5-a]pyrazine?
4-[(2,5-dimethylphenyl)methylsulfanyl]-2-thiophen-2-ylpyrazolo[1,5-a]pyrazine has a molecular weight of 351.50 g/mol, XLogP of 5.37, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,5-dimethylphenyl)methylsulfanyl]-2-thiophen-2-ylpyrazolo[1,5-a]pyrazine is sourced from PubChem (CID 27373094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).