About 1-fluoro-4,6-dimethylpyridin-1-ium-2-sulfonate
1-fluoro-4,6-dimethylpyridin-1-ium-2-sulfonate (PubChem CID 2737313) has the molecular formula C7H8FNO3S
and a molecular weight of 205.21 g/mol. Its IUPAC name is 1-fluoro-4,6-dimethylpyridin-1-ium-2-sulfonate.
Molecular Properties
| Compound Name | 1-fluoro-4,6-dimethylpyridin-1-ium-2-sulfonate |
| PubChem CID | 2737313 |
| Molecular Formula | C7H8FNO3S |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | 1-fluoro-4,6-dimethylpyridin-1-ium-2-sulfonate |
| SMILES | Cc1cc(C)[n+](F)c(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C7H8FNO3S/c1-5-3-6(2)9(8)7(4-5)13(10,11)12/h3-4H,1-2H3 |
| InChIKey | PCUDTDNTOMIWJB-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-4,6-dimethylpyridin-1-ium-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4,6-dimethylpyridin-1-ium-2-sulfonate?
The IUPAC name of 1-fluoro-4,6-dimethylpyridin-1-ium-2-sulfonate (CID 2737313) is 1-fluoro-4,6-dimethylpyridin-1-ium-2-sulfonate.
What is the SMILES notation for 1-fluoro-4,6-dimethylpyridin-1-ium-2-sulfonate?
The canonical SMILES for 1-fluoro-4,6-dimethylpyridin-1-ium-2-sulfonate is Cc1cc(C)[n+](F)c(S(=O)(=O)[O-])c1.
What is the InChIKey of 1-fluoro-4,6-dimethylpyridin-1-ium-2-sulfonate?
The InChIKey is PCUDTDNTOMIWJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FNO3S/c1-5-3-6(2)9(8)7(4-5)13(10,11)12/h3-4H,1-2H3.
What are the key properties of 1-fluoro-4,6-dimethylpyridin-1-ium-2-sulfonate?
1-fluoro-4,6-dimethylpyridin-1-ium-2-sulfonate has a molecular weight of 205.21 g/mol, XLogP of 0.23, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4,6-dimethylpyridin-1-ium-2-sulfonate is sourced from PubChem (CID 2737313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).