C21H22N4O2S2 — CID 27373462
2-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-3-pentylthieno[3,2-d]pyrimidin-4-one (PubChem CID 27373462) has the molecular formula C21H22N4O2S2 and a molecular weight of 426.57 g/mol. Its IUPAC name is 2-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-3-pentylthieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-3-pentylthieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 27373462 |
| Molecular Formula | C21H22N4O2S2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 2-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-3-pentylthieno[3,2-d]pyrimidin-4-one |
| SMILES | CCCCCn1c(SCc2nc(-c3cccc(C)c3)no2)nc2ccsc2c1=O |
| InChI | InChI=1S/C21H22N4O2S2/c1-3-4-5-10-25-20(26)18-16(9-11-28-18)22-21(25)29-13-17-23-19(24-27-17)15-8-6-7-14(2)12-15/h6-9,11-12H,3-5,10,13H2,1-2H3 |
| InChIKey | VQHTXTUSHQABIC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|