About 4-fluoro-2-methoxyphenol
4-fluoro-2-methoxyphenol (PubChem CID 2737368) has the molecular formula C7H7FO2
and a molecular weight of 142.13 g/mol. Its IUPAC name is 4-fluoro-2-methoxyphenol.
Molecular Properties
| Compound Name | 4-fluoro-2-methoxyphenol |
| PubChem CID | 2737368 |
| Molecular Formula | C7H7FO2 |
| Molecular Weight | 142.13 g/mol |
| Exact Mass | 142.04 |
| IUPAC Name | 4-fluoro-2-methoxyphenol |
| SMILES | COc1cc(F)ccc1O |
| InChI | InChI=1S/C7H7FO2/c1-10-7-4-5(8)2-3-6(7)9/h2-4,9H,1H3 |
| InChIKey | OULGLTLTWBZBLO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.13 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoro-2-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2-methoxyphenol?
The IUPAC name of 4-fluoro-2-methoxyphenol (CID 2737368) is 4-fluoro-2-methoxyphenol.
What is the SMILES notation for 4-fluoro-2-methoxyphenol?
The canonical SMILES for 4-fluoro-2-methoxyphenol is COc1cc(F)ccc1O.
What is the InChIKey of 4-fluoro-2-methoxyphenol?
The InChIKey is OULGLTLTWBZBLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FO2/c1-10-7-4-5(8)2-3-6(7)9/h2-4,9H,1H3.
What are the key properties of 4-fluoro-2-methoxyphenol?
4-fluoro-2-methoxyphenol has a molecular weight of 142.13 g/mol, XLogP of 1.54, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2-methoxyphenol is sourced from PubChem (CID 2737368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).