C20H16N6O4S2 — CID 27373902
7-[[3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-2-thiophen-2-yl-5H-pyrazolo[1,5-d][1,2,4]triazin-4-one (PubChem CID 27373902) has the molecular formula C20H16N6O4S2 and a molecular weight of 468.52 g/mol. Its IUPAC name is 7-[[3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-2-thiophen-2-yl-5H-pyrazolo[1,5-d][1,2,4]triazin-4-one.
| Compound Name | 7-[[3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-2-thiophen-2-yl-5H-pyrazolo[1,5-d][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 27373902 |
| Molecular Formula | C20H16N6O4S2 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 7-[[3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-2-thiophen-2-yl-5H-pyrazolo[1,5-d][1,2,4]triazin-4-one |
| SMILES | COc1cc(OC)cc(-c2noc(CSc3n[nH]c(=O)c4cc(-c5cccs5)nn34)n2)c1 |
| InChI | InChI=1S/C20H16N6O4S2/c1-28-12-6-11(7-13(8-12)29-2)18-21-17(30-25-18)10-32-20-23-22-19(27)15-9-14(24-26(15)20)16-4-3-5-31-16/h3-9H,10H2,1-2H3,(H,22,27) |
| InChIKey | RONRQPFNFOYPCP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 120.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |