C25H19N3O3S2 — CID 27374113
5-benzyl-4-[2-(3-methoxyphenyl)-2-oxoethyl]sulfanyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 27374113) has the molecular formula C25H19N3O3S2 and a molecular weight of 473.58 g/mol. Its IUPAC name is 5-benzyl-4-[2-(3-methoxyphenyl)-2-oxoethyl]sulfanyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 5-benzyl-4-[2-(3-methoxyphenyl)-2-oxoethyl]sulfanyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 27374113 |
| Molecular Formula | C25H19N3O3S2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 5-benzyl-4-[2-(3-methoxyphenyl)-2-oxoethyl]sulfanyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | COc1cccc(C(=O)CSc2nc3c(sc4ncccc43)c(=O)n2Cc2ccccc2)c1 |
| InChI | InChI=1S/C25H19N3O3S2/c1-31-18-10-5-9-17(13-18)20(29)15-32-25-27-21-19-11-6-12-26-23(19)33-22(21)24(30)28(25)14-16-7-3-2-4-8-16/h2-13H,14-15H2,1H3 |
| InChIKey | CHMACCZRMPQOST-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |