About ethyl 2,6-dichlorobenzoate
ethyl 2,6-dichlorobenzoate (PubChem CID 2737439) has the molecular formula C9H8Cl2O2
and a molecular weight of 219.07 g/mol. Its IUPAC name is ethyl 2,6-dichlorobenzoate.
Molecular Properties
| Compound Name | ethyl 2,6-dichlorobenzoate |
| PubChem CID | 2737439 |
| Molecular Formula | C9H8Cl2O2 |
| Molecular Weight | 219.07 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | ethyl 2,6-dichlorobenzoate |
| SMILES | CCOC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H8Cl2O2/c1-2-13-9(12)8-6(10)4-3-5-7(8)11/h3-5H,2H2,1H3 |
| InChIKey | HAFAMHIZRCDTSS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.07 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 2,6-dichlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2,6-dichlorobenzoate?
The IUPAC name of ethyl 2,6-dichlorobenzoate (CID 2737439) is ethyl 2,6-dichlorobenzoate.
What is the SMILES notation for ethyl 2,6-dichlorobenzoate?
The canonical SMILES for ethyl 2,6-dichlorobenzoate is CCOC(=O)c1c(Cl)cccc1Cl.
What is the InChIKey of ethyl 2,6-dichlorobenzoate?
The InChIKey is HAFAMHIZRCDTSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8Cl2O2/c1-2-13-9(12)8-6(10)4-3-5-7(8)11/h3-5H,2H2,1H3.
What are the key properties of ethyl 2,6-dichlorobenzoate?
ethyl 2,6-dichlorobenzoate has a molecular weight of 219.07 g/mol, XLogP of 3.17, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,6-dichlorobenzoate is sourced from PubChem (CID 2737439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).