methyl 1,3-thiazolidine-2-carboxylate;hydrochloride

C5H10ClNO2S — CID 2737506

IUPACmethyl 1,3-thiazolidine-2-carboxylate;hydrochloride
SMILESCOC(=O)C1NCCS1.Cl
InChIInChI=1S/C5H9NO2S.ClH/c1-8-5(7)4-6-2-3-9-4;/h4,6H,2-3H2,1H3;1H
InChIKeyYGTQIXUXZVNVKG-UHFFFAOYSA-N
MW183.66 g/mol
LogP0.24
Rot. Bonds1

About methyl 1,3-thiazolidine-2-carboxylate;hydrochloride

methyl 1,3-thiazolidine-2-carboxylate;hydrochloride (PubChem CID 2737506) has the molecular formula C5H10ClNO2S and a molecular weight of 183.66 g/mol. Its IUPAC name is methyl 1,3-thiazolidine-2-carboxylate;hydrochloride.

Molecular Properties

Compound Namemethyl 1,3-thiazolidine-2-carboxylate;hydrochloride
PubChem CID2737506
Molecular FormulaC5H10ClNO2S
Molecular Weight183.66 g/mol
Exact Mass183.01
IUPAC Namemethyl 1,3-thiazolidine-2-carboxylate;hydrochloride
SMILESCOC(=O)C1NCCS1.Cl
InChIInChI=1S/C5H9NO2S.ClH/c1-8-5(7)4-6-2-3-9-4;/h4,6H,2-3H2,1H3;1H
InChIKeyYGTQIXUXZVNVKG-UHFFFAOYSA-N
XLogP0.24
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.66
LogP ≤ 50.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 1,3-thiazolidine-2-carboxylate;hydrochloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1,3-thiazolidine-2-carboxylate;hydrochloride?
The IUPAC name of methyl 1,3-thiazolidine-2-carboxylate;hydrochloride (CID 2737506) is methyl 1,3-thiazolidine-2-carboxylate;hydrochloride.
What is the SMILES notation for methyl 1,3-thiazolidine-2-carboxylate;hydrochloride?
The canonical SMILES for methyl 1,3-thiazolidine-2-carboxylate;hydrochloride is COC(=O)C1NCCS1.Cl.
What is the InChIKey of methyl 1,3-thiazolidine-2-carboxylate;hydrochloride?
The InChIKey is YGTQIXUXZVNVKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2S.ClH/c1-8-5(7)4-6-2-3-9-4;/h4,6H,2-3H2,1H3;1H.
What are the key properties of methyl 1,3-thiazolidine-2-carboxylate;hydrochloride?
methyl 1,3-thiazolidine-2-carboxylate;hydrochloride has a molecular weight of 183.66 g/mol, XLogP of 0.24, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1,3-thiazolidine-2-carboxylate;hydrochloride is sourced from PubChem (CID 2737506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).