C14H17N3O3S3 — CID 27376012
N'-(2,5-dimethylphenyl)sulfonyl-3,4-dimethyl-2-sulfanylidene-1,3-thiazole-5-carbohydrazide (PubChem CID 27376012) has the molecular formula C14H17N3O3S3 and a molecular weight of 371.51 g/mol. Its IUPAC name is N'-(2,5-dimethylphenyl)sulfonyl-3,4-dimethyl-2-sulfanylidene-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-(2,5-dimethylphenyl)sulfonyl-3,4-dimethyl-2-sulfanylidene-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 27376012 |
| Molecular Formula | C14H17N3O3S3 |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | N'-(2,5-dimethylphenyl)sulfonyl-3,4-dimethyl-2-sulfanylidene-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NNC(=O)c2sc(=S)n(C)c2C)c1 |
| InChI | InChI=1S/C14H17N3O3S3/c1-8-5-6-9(2)11(7-8)23(19,20)16-15-13(18)12-10(3)17(4)14(21)22-12/h5-7,16H,1-4H3,(H,15,18) |
| InChIKey | VZEYTOXJJOTBQF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|