C7H7F7O — CID 2737631
1,1,1,2,2,3,3-heptafluoro-4-prop-2-enoxybutane (PubChem CID 2737631) has the molecular formula C7H7F7O and a molecular weight of 240.12 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoro-4-prop-2-enoxybutane.
| Compound Name | 1,1,1,2,2,3,3-heptafluoro-4-prop-2-enoxybutane |
|---|---|
| PubChem CID | 2737631 |
| Molecular Formula | C7H7F7O |
| Molecular Weight | 240.12 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoro-4-prop-2-enoxybutane |
| SMILES | C=CCOCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H7F7O/c1-2-3-15-4-5(8,9)6(10,11)7(12,13)14/h2H,1,3-4H2 |
| InChIKey | OLXJWIOOAUUDHX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.12 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|