About methyl 1-[3-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoyl]piperidine-4-carboxylate
methyl 1-[3-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoyl]piperidine-4-carboxylate (PubChem CID 27377146) has the molecular formula C21H22ClN3O3S
and a molecular weight of 431.95 g/mol. Its IUPAC name is methyl 1-[3-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoyl]piperidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[3-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoyl]piperidine-4-carboxylate |
| PubChem CID | 27377146 |
| Molecular Formula | C21H22ClN3O3S |
| Molecular Weight | 431.95 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | methyl 1-[3-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)CCc2csc3nc(-c4ccc(Cl)cc4)cn23)CC1 |
| InChI | InChI=1S/C21H22ClN3O3S/c1-28-20(27)15-8-10-24(11-9-15)19(26)7-6-17-13-29-21-23-18(12-25(17)21)14-2-4-16(22)5-3-14/h2-5,12-13,15H,6-11H2,1H3 |
| InChIKey | PHUXULFCEVYMGB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.95 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 1-[3-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoyl]piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[3-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoyl]piperidine-4-carboxylate?
The IUPAC name of methyl 1-[3-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoyl]piperidine-4-carboxylate (CID 27377146) is methyl 1-[3-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoyl]piperidine-4-carboxylate.
What is the SMILES notation for methyl 1-[3-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoyl]piperidine-4-carboxylate?
The canonical SMILES for methyl 1-[3-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoyl]piperidine-4-carboxylate is COC(=O)C1CCN(C(=O)CCc2csc3nc(-c4ccc(Cl)cc4)cn23)CC1.
What is the InChIKey of methyl 1-[3-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoyl]piperidine-4-carboxylate?
The InChIKey is PHUXULFCEVYMGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22ClN3O3S/c1-28-20(27)15-8-10-24(11-9-15)19(26)7-6-17-13-29-21-23-18(12-25(17)21)14-2-4-16(22)5-3-14/h2-5,12-13,15H,6-11H2,1H3.
What are the key properties of methyl 1-[3-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoyl]piperidine-4-carboxylate?
methyl 1-[3-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoyl]piperidine-4-carboxylate has a molecular weight of 431.95 g/mol, XLogP of 4.06, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[3-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]propanoyl]piperidine-4-carboxylate is sourced from PubChem (CID 27377146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).