About 2-[[(4-amino-9,10-dioxoanthracen-1-yl)amino]methylidene]propanedinitrile
2-[[(4-amino-9,10-dioxoanthracen-1-yl)amino]methylidene]propanedinitrile (PubChem CID 2737762) has the molecular formula C18H10N4O2
and a molecular weight of 314.30 g/mol. Its IUPAC name is 2-[[(4-amino-9,10-dioxoanthracen-1-yl)amino]methylidene]propanedinitrile.
Molecular Properties
| Compound Name | 2-[[(4-amino-9,10-dioxoanthracen-1-yl)amino]methylidene]propanedinitrile |
| PubChem CID | 2737762 |
| Molecular Formula | C18H10N4O2 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-[[(4-amino-9,10-dioxoanthracen-1-yl)amino]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1ccc(N)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H10N4O2/c19-7-10(8-20)9-22-14-6-5-13(21)15-16(14)18(24)12-4-2-1-3-11(12)17(15)23/h1-6,9,22H,21H2 |
| InChIKey | KJPSRUPSOPWLMB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(4-amino-9,10-dioxoanthracen-1-yl)amino]methylidene]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(4-amino-9,10-dioxoanthracen-1-yl)amino]methylidene]propanedinitrile?
The IUPAC name of 2-[[(4-amino-9,10-dioxoanthracen-1-yl)amino]methylidene]propanedinitrile (CID 2737762) is 2-[[(4-amino-9,10-dioxoanthracen-1-yl)amino]methylidene]propanedinitrile.
What is the SMILES notation for 2-[[(4-amino-9,10-dioxoanthracen-1-yl)amino]methylidene]propanedinitrile?
The canonical SMILES for 2-[[(4-amino-9,10-dioxoanthracen-1-yl)amino]methylidene]propanedinitrile is N#CC(C#N)=CNc1ccc(N)c2c1C(=O)c1ccccc1C2=O.
What is the InChIKey of 2-[[(4-amino-9,10-dioxoanthracen-1-yl)amino]methylidene]propanedinitrile?
The InChIKey is KJPSRUPSOPWLMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10N4O2/c19-7-10(8-20)9-22-14-6-5-13(21)15-16(14)18(24)12-4-2-1-3-11(12)17(15)23/h1-6,9,22H,21H2.
What are the key properties of 2-[[(4-amino-9,10-dioxoanthracen-1-yl)amino]methylidene]propanedinitrile?
2-[[(4-amino-9,10-dioxoanthracen-1-yl)amino]methylidene]propanedinitrile has a molecular weight of 314.30 g/mol, XLogP of 2.39, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(4-amino-9,10-dioxoanthracen-1-yl)amino]methylidene]propanedinitrile is sourced from PubChem (CID 2737762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).