C15H23N3O3 — CID 27377650
8-(cyclopentanecarbonyl)-1,3-dimethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 27377650) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 8-(cyclopentanecarbonyl)-1,3-dimethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(cyclopentanecarbonyl)-1,3-dimethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 27377650 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 8-(cyclopentanecarbonyl)-1,3-dimethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CN1C(=O)N(C)C2(CCN(C(=O)C3CCCC3)CC2)C1=O |
| InChI | InChI=1S/C15H23N3O3/c1-16-13(20)15(17(2)14(16)21)7-9-18(10-8-15)12(19)11-5-3-4-6-11/h11H,3-10H2,1-2H3 |
| InChIKey | KJSSCIIFZOFLEZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|