About 2-(2-anilino-1,3-thiazol-4-yl)-N-[(4-fluorophenyl)methyl]acetamide
2-(2-anilino-1,3-thiazol-4-yl)-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 27377714) has the molecular formula C18H16FN3OS
and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-(2-anilino-1,3-thiazol-4-yl)-N-[(4-fluorophenyl)methyl]acetamide.
Molecular Properties
| Compound Name | 2-(2-anilino-1,3-thiazol-4-yl)-N-[(4-fluorophenyl)methyl]acetamide |
| PubChem CID | 27377714 |
| Molecular Formula | C18H16FN3OS |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-(2-anilino-1,3-thiazol-4-yl)-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | O=C(Cc1csc(Nc2ccccc2)n1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H16FN3OS/c19-14-8-6-13(7-9-14)11-20-17(23)10-16-12-24-18(22-16)21-15-4-2-1-3-5-15/h1-9,12H,10-11H2,(H,20,23)(H,21,22) |
| InChIKey | FZLXBFNODVOBJK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-anilino-1,3-thiazol-4-yl)-N-[(4-fluorophenyl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-anilino-1,3-thiazol-4-yl)-N-[(4-fluorophenyl)methyl]acetamide?
The IUPAC name of 2-(2-anilino-1,3-thiazol-4-yl)-N-[(4-fluorophenyl)methyl]acetamide (CID 27377714) is 2-(2-anilino-1,3-thiazol-4-yl)-N-[(4-fluorophenyl)methyl]acetamide.
What is the SMILES notation for 2-(2-anilino-1,3-thiazol-4-yl)-N-[(4-fluorophenyl)methyl]acetamide?
The canonical SMILES for 2-(2-anilino-1,3-thiazol-4-yl)-N-[(4-fluorophenyl)methyl]acetamide is O=C(Cc1csc(Nc2ccccc2)n1)NCc1ccc(F)cc1.
What is the InChIKey of 2-(2-anilino-1,3-thiazol-4-yl)-N-[(4-fluorophenyl)methyl]acetamide?
The InChIKey is FZLXBFNODVOBJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16FN3OS/c19-14-8-6-13(7-9-14)11-20-17(23)10-16-12-24-18(22-16)21-15-4-2-1-3-5-15/h1-9,12H,10-11H2,(H,20,23)(H,21,22).
What are the key properties of 2-(2-anilino-1,3-thiazol-4-yl)-N-[(4-fluorophenyl)methyl]acetamide?
2-(2-anilino-1,3-thiazol-4-yl)-N-[(4-fluorophenyl)methyl]acetamide has a molecular weight of 341.41 g/mol, XLogP of 3.88, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-anilino-1,3-thiazol-4-yl)-N-[(4-fluorophenyl)methyl]acetamide is sourced from PubChem (CID 27377714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).