About 2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide
2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide (PubChem CID 27377870) has the molecular formula C18H17FN4O3S2
and a molecular weight of 420.49 g/mol. Its IUPAC name is 2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide.
Molecular Properties
| Compound Name | 2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide |
| PubChem CID | 27377870 |
| Molecular Formula | C18H17FN4O3S2 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)Cc2csc(Nc3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C18H17FN4O3S2/c19-13-3-5-14(6-4-13)22-18-23-15(11-27-18)9-17(24)21-10-12-1-7-16(8-2-12)28(20,25)26/h1-8,11H,9-10H2,(H,21,24)(H,22,23)(H2,20,25,26) |
| InChIKey | DUGBYHWYIOECCG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide?
The IUPAC name of 2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide (CID 27377870) is 2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide.
What is the SMILES notation for 2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide?
The canonical SMILES for 2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide is NS(=O)(=O)c1ccc(CNC(=O)Cc2csc(Nc3ccc(F)cc3)n2)cc1.
What is the InChIKey of 2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide?
The InChIKey is DUGBYHWYIOECCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17FN4O3S2/c19-13-3-5-14(6-4-13)22-18-23-15(11-27-18)9-17(24)21-10-12-1-7-16(8-2-12)28(20,25)26/h1-8,11H,9-10H2,(H,21,24)(H,22,23)(H2,20,25,26).
What are the key properties of 2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide?
2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide has a molecular weight of 420.49 g/mol, XLogP of 2.53, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]-N-[(4-sulfamoylphenyl)methyl]acetamide is sourced from PubChem (CID 27377870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).