About 1-[4-(4-acetylphenyl)piperazin-1-yl]-2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]ethanone
1-[4-(4-acetylphenyl)piperazin-1-yl]-2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]ethanone (PubChem CID 27377898) has the molecular formula C23H23FN4O2S
and a molecular weight of 438.53 g/mol. Its IUPAC name is 1-[4-(4-acetylphenyl)piperazin-1-yl]-2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(4-acetylphenyl)piperazin-1-yl]-2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]ethanone |
| PubChem CID | 27377898 |
| Molecular Formula | C23H23FN4O2S |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 1-[4-(4-acetylphenyl)piperazin-1-yl]-2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCN(C(=O)Cc3csc(Nc4ccc(F)cc4)n3)CC2)cc1 |
| InChI | InChI=1S/C23H23FN4O2S/c1-16(29)17-2-8-21(9-3-17)27-10-12-28(13-11-27)22(30)14-20-15-31-23(26-20)25-19-6-4-18(24)5-7-19/h2-9,15H,10-14H2,1H3,(H,25,26) |
| InChIKey | USNBDHNPNSVPIV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-(4-acetylphenyl)piperazin-1-yl]-2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-acetylphenyl)piperazin-1-yl]-2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]ethanone?
The IUPAC name of 1-[4-(4-acetylphenyl)piperazin-1-yl]-2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]ethanone (CID 27377898) is 1-[4-(4-acetylphenyl)piperazin-1-yl]-2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]ethanone.
What is the SMILES notation for 1-[4-(4-acetylphenyl)piperazin-1-yl]-2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]ethanone?
The canonical SMILES for 1-[4-(4-acetylphenyl)piperazin-1-yl]-2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]ethanone is CC(=O)c1ccc(N2CCN(C(=O)Cc3csc(Nc4ccc(F)cc4)n3)CC2)cc1.
What is the InChIKey of 1-[4-(4-acetylphenyl)piperazin-1-yl]-2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]ethanone?
The InChIKey is USNBDHNPNSVPIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23FN4O2S/c1-16(29)17-2-8-21(9-3-17)27-10-12-28(13-11-27)22(30)14-20-15-31-23(26-20)25-19-6-4-18(24)5-7-19/h2-9,15H,10-14H2,1H3,(H,25,26).
What are the key properties of 1-[4-(4-acetylphenyl)piperazin-1-yl]-2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]ethanone?
1-[4-(4-acetylphenyl)piperazin-1-yl]-2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]ethanone has a molecular weight of 438.53 g/mol, XLogP of 4.12, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-acetylphenyl)piperazin-1-yl]-2-[2-(4-fluoroanilino)-1,3-thiazol-4-yl]ethanone is sourced from PubChem (CID 27377898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).