C22H23N3O4S — CID 27378169
methyl 4-[(3S)-1,1-dioxothiolan-3-yl]-6-(4-methylphenyl)-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraene-8-carboxylate (PubChem CID 27378169) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is methyl 4-[(3S)-1,1-dioxothiolan-3-yl]-6-(4-methylphenyl)-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraene-8-carboxylate.
| Compound Name | methyl 4-[(3S)-1,1-dioxothiolan-3-yl]-6-(4-methylphenyl)-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraene-8-carboxylate |
|---|---|
| PubChem CID | 27378169 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | methyl 4-[(3S)-1,1-dioxothiolan-3-yl]-6-(4-methylphenyl)-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraene-8-carboxylate |
| SMILES | COC(=O)c1c2c(nc3c1c(-c1ccc(C)cc1)nn3[C@H]1CCS(=O)(=O)C1)CCC2 |
| InChI | InChI=1S/C22H23N3O4S/c1-13-6-8-14(9-7-13)20-19-18(22(26)29-2)16-4-3-5-17(16)23-21(19)25(24-20)15-10-11-30(27,28)12-15/h6-9,15H,3-5,10-12H2,1-2H3/t15-/m0/s1 |
| InChIKey | YLVUYXWGVIRYHJ-HNNXBMFYSA-N |
| XLogP | 3.04 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |