About ethyl [(2-oxo-1,2-diphenylethylidene)amino] carbonate
ethyl [(2-oxo-1,2-diphenylethylidene)amino] carbonate (PubChem CID 2738122) has the molecular formula C17H15NO4
and a molecular weight of 297.31 g/mol. Its IUPAC name is ethyl [(2-oxo-1,2-diphenylethylidene)amino] carbonate.
Molecular Properties
| Compound Name | ethyl [(2-oxo-1,2-diphenylethylidene)amino] carbonate |
| PubChem CID | 2738122 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | ethyl [(2-oxo-1,2-diphenylethylidene)amino] carbonate |
| SMILES | CCOC(=O)ON=C(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H15NO4/c1-2-21-17(20)22-18-15(13-9-5-3-6-10-13)16(19)14-11-7-4-8-12-14/h3-12H,2H2,1H3 |
| InChIKey | OCLNYWSLIPQUJX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl [(2-oxo-1,2-diphenylethylidene)amino] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl [(2-oxo-1,2-diphenylethylidene)amino] carbonate?
The IUPAC name of ethyl [(2-oxo-1,2-diphenylethylidene)amino] carbonate (CID 2738122) is ethyl [(2-oxo-1,2-diphenylethylidene)amino] carbonate.
What is the SMILES notation for ethyl [(2-oxo-1,2-diphenylethylidene)amino] carbonate?
The canonical SMILES for ethyl [(2-oxo-1,2-diphenylethylidene)amino] carbonate is CCOC(=O)ON=C(C(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of ethyl [(2-oxo-1,2-diphenylethylidene)amino] carbonate?
The InChIKey is OCLNYWSLIPQUJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO4/c1-2-21-17(20)22-18-15(13-9-5-3-6-10-13)16(19)14-11-7-4-8-12-14/h3-12H,2H2,1H3.
What are the key properties of ethyl [(2-oxo-1,2-diphenylethylidene)amino] carbonate?
ethyl [(2-oxo-1,2-diphenylethylidene)amino] carbonate has a molecular weight of 297.31 g/mol, XLogP of 3.45, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl [(2-oxo-1,2-diphenylethylidene)amino] carbonate is sourced from PubChem (CID 2738122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).