About 1-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea
1-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 2738200) has the molecular formula C19H16F3N3O2
and a molecular weight of 375.35 g/mol. Its IUPAC name is 1-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea.
Molecular Properties
| Compound Name | 1-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea |
| PubChem CID | 2738200 |
| Molecular Formula | C19H16F3N3O2 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 1-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1onc(-c2ccccc2)c1CNC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16F3N3O2/c1-12-16(17(25-27-12)13-5-3-2-4-6-13)11-23-18(26)24-15-9-7-14(8-10-15)19(20,21)22/h2-10H,11H2,1H3,(H2,23,24,26) |
| InChIKey | AJKNDSFVCHTQTN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea?
The IUPAC name of 1-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea (CID 2738200) is 1-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea.
What is the SMILES notation for 1-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea?
The canonical SMILES for 1-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea is Cc1onc(-c2ccccc2)c1CNC(=O)Nc1ccc(C(F)(F)F)cc1.
What is the InChIKey of 1-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea?
The InChIKey is AJKNDSFVCHTQTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F3N3O2/c1-12-16(17(25-27-12)13-5-3-2-4-6-13)11-23-18(26)24-15-9-7-14(8-10-15)19(20,21)22/h2-10H,11H2,1H3,(H2,23,24,26).
What are the key properties of 1-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea?
1-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea has a molecular weight of 375.35 g/mol, XLogP of 4.99, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea is sourced from PubChem (CID 2738200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).