C11H8ClF4NO3 — CID 2738282
4-[(2-chlorophenyl)methylamino]-2,2,3,3-tetrafluoro-4-oxobutanoic acid (PubChem CID 2738282) has the molecular formula C11H8ClF4NO3 and a molecular weight of 313.63 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methylamino]-2,2,3,3-tetrafluoro-4-oxobutanoic acid.
| Compound Name | 4-[(2-chlorophenyl)methylamino]-2,2,3,3-tetrafluoro-4-oxobutanoic acid |
|---|---|
| PubChem CID | 2738282 |
| Molecular Formula | C11H8ClF4NO3 |
| Molecular Weight | 313.63 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 4-[(2-chlorophenyl)methylamino]-2,2,3,3-tetrafluoro-4-oxobutanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C11H8ClF4NO3/c12-7-4-2-1-3-6(7)5-17-8(18)10(13,14)11(15,16)9(19)20/h1-4H,5H2,(H,17,18)(H,19,20) |
| InChIKey | LKMSBARNTLOXSH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.63 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|