C19H16N4O3S2 — CID 2738474
5-(1,2-oxazol-3-yl)-N,N-bis(pyridin-2-ylmethyl)thiophene-2-sulfonamide (PubChem CID 2738474) has the molecular formula C19H16N4O3S2 and a molecular weight of 412.50 g/mol. Its IUPAC name is 5-(1,2-oxazol-3-yl)-N,N-bis(pyridin-2-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | 5-(1,2-oxazol-3-yl)-N,N-bis(pyridin-2-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2738474 |
| Molecular Formula | C19H16N4O3S2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 5-(1,2-oxazol-3-yl)-N,N-bis(pyridin-2-ylmethyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(c1ccc(-c2ccon2)s1)N(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C19H16N4O3S2/c24-28(25,19-8-7-18(27-19)17-9-12-26-22-17)23(13-15-5-1-3-10-20-15)14-16-6-2-4-11-21-16/h1-12H,13-14H2 |
| InChIKey | JYFSHHMSGLNMNP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 89.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |